C18H16BrClO2S — CID 138969948
[(E)-3-(4-bromophenyl)-3-chloro-2-(4-methylphenyl)sulfanylprop-2-enyl] acetate (PubChem CID 138969948) has the molecular formula C18H16BrClO2S and a molecular weight of 411.75 g/mol. Its IUPAC name is [(E)-3-(4-bromophenyl)-3-chloro-2-(4-methylphenyl)sulfanylprop-2-enyl] acetate.
| Compound Name | [(E)-3-(4-bromophenyl)-3-chloro-2-(4-methylphenyl)sulfanylprop-2-enyl] acetate |
|---|---|
| PubChem CID | 138969948 |
| Molecular Formula | C18H16BrClO2S |
| Molecular Weight | 411.75 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | [(E)-3-(4-bromophenyl)-3-chloro-2-(4-methylphenyl)sulfanylprop-2-enyl] acetate |
| SMILES | CC(=O)OC/C(Sc1ccc(C)cc1)=C(\Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H16BrClO2S/c1-12-3-9-16(10-4-12)23-17(11-22-13(2)21)18(20)14-5-7-15(19)8-6-14/h3-10H,11H2,1-2H3/b18-17+ |
| InChIKey | XSDJOMHPMCKTRI-ISLYRVAYSA-N |
| XLogP | 6.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.75 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |