About octyl 2-bromo-3-oxopropanoate
octyl 2-bromo-3-oxopropanoate (PubChem CID 132916305) has the molecular formula C11H19BrO3
and a molecular weight of 279.17 g/mol. Its IUPAC name is octyl 2-bromo-3-oxopropanoate.
Molecular Properties
| Compound Name | octyl 2-bromo-3-oxopropanoate |
| PubChem CID | 132916305 |
| Molecular Formula | C11H19BrO3 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | octyl 2-bromo-3-oxopropanoate |
| SMILES | CCCCCCCCOC(=O)C(Br)C=O |
| InChI | InChI=1S/C11H19BrO3/c1-2-3-4-5-6-7-8-15-11(14)10(12)9-13/h9-10H,2-8H2,1H3 |
| InChIKey | UAVBGUKJFUMNLF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze octyl 2-bromo-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 2-bromo-3-oxopropanoate?
The IUPAC name of octyl 2-bromo-3-oxopropanoate (CID 132916305) is octyl 2-bromo-3-oxopropanoate.
What is the SMILES notation for octyl 2-bromo-3-oxopropanoate?
The canonical SMILES for octyl 2-bromo-3-oxopropanoate is CCCCCCCCOC(=O)C(Br)C=O.
What is the InChIKey of octyl 2-bromo-3-oxopropanoate?
The InChIKey is UAVBGUKJFUMNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrO3/c1-2-3-4-5-6-7-8-15-11(14)10(12)9-13/h9-10H,2-8H2,1H3.
What are the key properties of octyl 2-bromo-3-oxopropanoate?
octyl 2-bromo-3-oxopropanoate has a molecular weight of 279.17 g/mol, XLogP of 2.85, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 2-bromo-3-oxopropanoate is sourced from PubChem (CID 132916305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).