C19H33NO4Si — CID 132918944
(2S)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydroxy-2-phenylmethoxybutanamide (PubChem CID 132918944) has the molecular formula C19H33NO4Si and a molecular weight of 367.56 g/mol. Its IUPAC name is (2S)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydroxy-2-phenylmethoxybutanamide.
| Compound Name | (2S)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydroxy-2-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 132918944 |
| Molecular Formula | C19H33NO4Si |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | (2S)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydroxy-2-phenylmethoxybutanamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCNC(=O)[C@H](CCO)OCc1ccccc1 |
| InChI | InChI=1S/C19H33NO4Si/c1-19(2,3)25(4,5)24-14-12-20-18(22)17(11-13-21)23-15-16-9-7-6-8-10-16/h6-10,17,21H,11-15H2,1-5H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | VBTGUBIRPPBOOC-KRWDZBQOSA-N |
| XLogP | 3.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|