C17H25NO2Si — CID 15447302
N-(2-phenylmethoxyethyl)-5-trimethylsilylpent-4-ynamide (PubChem CID 15447302) has the molecular formula C17H25NO2Si and a molecular weight of 303.48 g/mol. Its IUPAC name is N-(2-phenylmethoxyethyl)-5-trimethylsilylpent-4-ynamide.
| Compound Name | N-(2-phenylmethoxyethyl)-5-trimethylsilylpent-4-ynamide |
|---|---|
| PubChem CID | 15447302 |
| Molecular Formula | C17H25NO2Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-(2-phenylmethoxyethyl)-5-trimethylsilylpent-4-ynamide |
| SMILES | C[Si](C)(C)C#CCCC(=O)NCCOCc1ccccc1 |
| InChI | InChI=1S/C17H25NO2Si/c1-21(2,3)14-8-7-11-17(19)18-12-13-20-15-16-9-5-4-6-10-16/h4-6,9-10H,7,11-13,15H2,1-3H3,(H,18,19) |
| InChIKey | HRYKQDJYNFSUPL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|