C27H37NO2Si — CID 134938687
N-[(3R)-1-[dimethyl(phenyl)silyl]-7-phenylmethoxyhept-1-yn-3-yl]-2,2-dimethylpropanamide (PubChem CID 134938687) has the molecular formula C27H37NO2Si and a molecular weight of 435.68 g/mol. Its IUPAC name is N-[(3R)-1-[dimethyl(phenyl)silyl]-7-phenylmethoxyhept-1-yn-3-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(3R)-1-[dimethyl(phenyl)silyl]-7-phenylmethoxyhept-1-yn-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 134938687 |
| Molecular Formula | C27H37NO2Si |
| Molecular Weight | 435.68 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N-[(3R)-1-[dimethyl(phenyl)silyl]-7-phenylmethoxyhept-1-yn-3-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N[C@@H](C#C[Si](C)(C)c1ccccc1)CCCCOCc1ccccc1 |
| InChI | InChI=1S/C27H37NO2Si/c1-27(2,3)26(29)28-24(19-21-31(4,5)25-17-10-7-11-18-25)16-12-13-20-30-22-23-14-8-6-9-15-23/h6-11,14-15,17-18,24H,12-13,16,20,22H2,1-5H3,(H,28,29)/t24-/m1/s1 |
| InChIKey | XTPKXHWATWPEIR-XMMPIXPASA-N |
| XLogP | 5.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|