C32H51N3O6Si — CID 134836509
benzyl (2S)-3,3-dimethyl-2-[[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-triethylsilylpent-4-ynoyl]amino]propanoyl]amino]butanoate (PubChem CID 134836509) has the molecular formula C32H51N3O6Si and a molecular weight of 601.86 g/mol. Its IUPAC name is benzyl (2S)-3,3-dimethyl-2-[[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-triethylsilylpent-4-ynoyl]amino]propanoyl]amino]butanoate.
| Compound Name | benzyl (2S)-3,3-dimethyl-2-[[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-triethylsilylpent-4-ynoyl]amino]propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 134836509 |
| Molecular Formula | C32H51N3O6Si |
| Molecular Weight | 601.86 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | benzyl (2S)-3,3-dimethyl-2-[[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-triethylsilylpent-4-ynoyl]amino]propanoyl]amino]butanoate |
| SMILES | CC[Si](C#CC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)OCc1ccccc1)C(C)(C)C)(CC)CC |
| InChI | InChI=1S/C32H51N3O6Si/c1-11-42(12-2,13-3)21-17-20-25(34-30(39)41-32(8,9)10)28(37)33-23(4)27(36)35-26(31(5,6)7)29(38)40-22-24-18-15-14-16-19-24/h14-16,18-19,23,25-26H,11-13,20,22H2,1-10H3,(H,33,37)(H,34,39)(H,35,36)/t23-,25-,26+/m0/s1 |
| InChIKey | FYROQWSJDKSRAQ-AYRHNUGRSA-N |
| XLogP | 5.10 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|