C30H44O4 — CID 132919154
(1R,2R,3S,7S,8R,10S)-3,10-dihydroxy-6,12-dimethyl-3,10-bis[(2S)-6-methylhept-5-en-2-yl]tricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (PubChem CID 132919154) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (1R,2R,3S,7S,8R,10S)-3,10-dihydroxy-6,12-dimethyl-3,10-bis[(2S)-6-methylhept-5-en-2-yl]tricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione.
| Compound Name | (1R,2R,3S,7S,8R,10S)-3,10-dihydroxy-6,12-dimethyl-3,10-bis[(2S)-6-methylhept-5-en-2-yl]tricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
|---|---|
| PubChem CID | 132919154 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (1R,2R,3S,7S,8R,10S)-3,10-dihydroxy-6,12-dimethyl-3,10-bis[(2S)-6-methylhept-5-en-2-yl]tricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| SMILES | CC(C)=CCC[C@H](C)[C@@]1(O)C(=O)C=C(C)[C@@H]2[C@H]3C(=O)[C@](O)([C@@H](C)CCC=C(C)C)[C@H](C=C3C)[C@@H]21 |
| InChI | InChI=1S/C30H44O4/c1-17(2)11-9-13-21(7)29(33)23-15-19(5)26(28(29)32)25-20(6)16-24(31)30(34,27(23)25)22(8)14-10-12-18(3)4/h11-12,15-16,21-23,25-27,33-34H,9-10,13-14H2,1-8H3/t21-,22-,23+,25+,26-,27-,29-,30+/m0/s1 |
| InChIKey | ULCRKUCNGNUAOQ-SEGWLYPUSA-N |
| XLogP | 5.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|