About pentan-3-yl carbonochloridate
pentan-3-yl carbonochloridate (PubChem CID 13292916) has the molecular formula C6H11ClO2
and a molecular weight of 150.60 g/mol. Its IUPAC name is pentan-3-yl carbonochloridate.
Molecular Properties
| Compound Name | pentan-3-yl carbonochloridate |
| PubChem CID | 13292916 |
| Molecular Formula | C6H11ClO2 |
| Molecular Weight | 150.60 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | pentan-3-yl carbonochloridate |
| SMILES | CCC(CC)OC(=O)Cl |
| InChI | InChI=1S/C6H11ClO2/c1-3-5(4-2)9-6(7)8/h5H,3-4H2,1-2H3 |
| InChIKey | QUZQVZBZYLHJGX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-yl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl carbonochloridate?
The IUPAC name of pentan-3-yl carbonochloridate (CID 13292916) is pentan-3-yl carbonochloridate.
What is the SMILES notation for pentan-3-yl carbonochloridate?
The canonical SMILES for pentan-3-yl carbonochloridate is CCC(CC)OC(=O)Cl.
What is the InChIKey of pentan-3-yl carbonochloridate?
The InChIKey is QUZQVZBZYLHJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO2/c1-3-5(4-2)9-6(7)8/h5H,3-4H2,1-2H3.
What are the key properties of pentan-3-yl carbonochloridate?
pentan-3-yl carbonochloridate has a molecular weight of 150.60 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl carbonochloridate is sourced from PubChem (CID 13292916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).