C24H24O6 — CID 132933625
diethyl 2-(2-oxo-2-phenylmethoxyethyl)indene-1,1-dicarboxylate (PubChem CID 132933625) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is diethyl 2-(2-oxo-2-phenylmethoxyethyl)indene-1,1-dicarboxylate.
| Compound Name | diethyl 2-(2-oxo-2-phenylmethoxyethyl)indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 132933625 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | diethyl 2-(2-oxo-2-phenylmethoxyethyl)indene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(CC(=O)OCc2ccccc2)=Cc2ccccc21 |
| InChI | InChI=1S/C24H24O6/c1-3-28-22(26)24(23(27)29-4-2)19(14-18-12-8-9-13-20(18)24)15-21(25)30-16-17-10-6-5-7-11-17/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | AMIPOLHPEGDTCR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|