C22H25NO2 — CID 132934478
N,N-diethyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide (PubChem CID 132934478) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N,N-diethyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide.
| Compound Name | N,N-diethyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide |
|---|---|
| PubChem CID | 132934478 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N,N-diethyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)OC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C22H25NO2/c1-4-23(5-2)21(24)20-16-22(25-17(20)3,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15H,4-5,16H2,1-3H3 |
| InChIKey | MVVVABWAWPBEND-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |