C19H27N3O2 — CID 132937260
7-benzyl-2-butyl-9a-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1,3-dione (PubChem CID 132937260) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 7-benzyl-2-butyl-9a-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1,3-dione.
| Compound Name | 7-benzyl-2-butyl-9a-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 132937260 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 7-benzyl-2-butyl-9a-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-1,3-dione |
| SMILES | CCCCN1C(=O)N2CCN(Cc3ccccc3)CCC2(C)C1=O |
| InChI | InChI=1S/C19H27N3O2/c1-3-4-11-21-17(23)19(2)10-12-20(13-14-22(19)18(21)24)15-16-8-6-5-7-9-16/h5-9H,3-4,10-15H2,1-2H3 |
| InChIKey | WPFGMSAZVABPAB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|