C19H25N3O4 — CID 132937261
ethyl 2-(7-benzyl-9a-methyl-1,3-dioxo-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepin-2-yl)acetate (PubChem CID 132937261) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is ethyl 2-(7-benzyl-9a-methyl-1,3-dioxo-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepin-2-yl)acetate.
| Compound Name | ethyl 2-(7-benzyl-9a-methyl-1,3-dioxo-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepin-2-yl)acetate |
|---|---|
| PubChem CID | 132937261 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | ethyl 2-(7-benzyl-9a-methyl-1,3-dioxo-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepin-2-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)N2CCN(Cc3ccccc3)CCC2(C)C1=O |
| InChI | InChI=1S/C19H25N3O4/c1-3-26-16(23)14-21-17(24)19(2)9-10-20(11-12-22(19)18(21)25)13-15-7-5-4-6-8-15/h4-8H,3,9-14H2,1-2H3 |
| InChIKey | CJQFKSOARUCSKG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|