C18H18O12 — CID 132937861
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(6-oxopyran-3-yl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate (PubChem CID 132937861) has the molecular formula C18H18O12 and a molecular weight of 426.33 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(6-oxopyran-3-yl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(6-oxopyran-3-yl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 132937861 |
| Molecular Formula | C18H18O12 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(6-oxopyran-3-yl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](Oc2ccc(=O)oc2)[C@H](O)[C@@H](O)[C@@H]1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C18H18O12/c19-9-3-7(4-10(20)13(9)22)17(26)28-6-11-14(23)15(24)16(25)18(30-11)29-8-1-2-12(21)27-5-8/h1-5,11,14-16,18-20,22-25H,6H2/t11-,14-,15+,16-,18-/m1/s1 |
| InChIKey | KYBBDOUWXTVSRJ-AJZPPWIDSA-N |
| XLogP | -1.20 |
| TPSA | 196.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|