C26H37N4O7+ — CID 132942342
dimethyl-(naphthalen-2-ylmethyl)-[2-[2-[4-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]triazol-1-yl]ethoxy]ethyl]azanium (PubChem CID 132942342) has the molecular formula C26H37N4O7+ and a molecular weight of 517.60 g/mol. Its IUPAC name is dimethyl-(naphthalen-2-ylmethyl)-[2-[2-[4-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]triazol-1-yl]ethoxy]ethyl]azanium.
| Compound Name | dimethyl-(naphthalen-2-ylmethyl)-[2-[2-[4-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]triazol-1-yl]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 132942342 |
| Molecular Formula | C26H37N4O7+ |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | dimethyl-(naphthalen-2-ylmethyl)-[2-[2-[4-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]triazol-1-yl]ethoxy]ethyl]azanium |
| SMILES | C[N+](C)(CCOCCn1cc(CO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)nn1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H37N4O7/c1-30(2,15-18-7-8-19-5-3-4-6-20(19)13-18)10-12-35-11-9-29-14-21(27-28-29)17-36-26-25(34)24(33)23(32)22(16-31)37-26/h3-8,13-14,22-26,31-34H,9-12,15-17H2,1-2H3/q+1/t22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | PYRBLUJOJZTNJL-RTJMFUJLSA-N |
| XLogP | 0.04 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|