About methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate
methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate (PubChem CID 132943093) has the molecular formula C12H13F5O2S
and a molecular weight of 316.29 g/mol. Its IUPAC name is methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate.
Molecular Properties
| Compound Name | methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate |
| PubChem CID | 132943093 |
| Molecular Formula | C12H13F5O2S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate |
| SMILES | C=CC(c1ccccc1)C(C(=O)OC)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C12H13F5O2S/c1-3-10(9-7-5-4-6-8-9)11(12(18)19-2)20(13,14,15,16)17/h3-8,10-11H,1H2,2H3 |
| InChIKey | OMLNJPYNAVNEHG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate?
The IUPAC name of methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate (CID 132943093) is methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate.
What is the SMILES notation for methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate?
The canonical SMILES for methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate is C=CC(c1ccccc1)C(C(=O)OC)S(F)(F)(F)(F)F.
What is the InChIKey of methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate?
The InChIKey is OMLNJPYNAVNEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F5O2S/c1-3-10(9-7-5-4-6-8-9)11(12(18)19-2)20(13,14,15,16)17/h3-8,10-11H,1H2,2H3.
What are the key properties of methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate?
methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate has a molecular weight of 316.29 g/mol, XLogP of 4.80, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(pentafluoro-λ6-sulfanyl)-3-phenylpent-4-enoate is sourced from PubChem (CID 132943093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).