C28H22Cl2O5 — CID 13295572
2,2-bis[[4-(4-chlorophenoxy)phenoxy]methyl]oxirane (PubChem CID 13295572) has the molecular formula C28H22Cl2O5 and a molecular weight of 509.39 g/mol. Its IUPAC name is 2,2-bis[[4-(4-chlorophenoxy)phenoxy]methyl]oxirane.
| Compound Name | 2,2-bis[[4-(4-chlorophenoxy)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 13295572 |
| Molecular Formula | C28H22Cl2O5 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 2,2-bis[[4-(4-chlorophenoxy)phenoxy]methyl]oxirane |
| SMILES | Clc1ccc(Oc2ccc(OCC3(COc4ccc(Oc5ccc(Cl)cc5)cc4)CO3)cc2)cc1 |
| InChI | InChI=1S/C28H22Cl2O5/c29-20-1-5-24(6-2-20)34-26-13-9-22(10-14-26)31-17-28(19-33-28)18-32-23-11-15-27(16-12-23)35-25-7-3-21(30)4-8-25/h1-16H,17-19H2 |
| InChIKey | KIFWRRUYAFEFHI-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|