C17H23NO — CID 132961416
1-(2,5-dimethylphenyl)-2-azaspiro[4.5]dec-1-en-3-ol (PubChem CID 132961416) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-azaspiro[4.5]dec-1-en-3-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-2-azaspiro[4.5]dec-1-en-3-ol |
|---|---|
| PubChem CID | 132961416 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-azaspiro[4.5]dec-1-en-3-ol |
| SMILES | Cc1ccc(C)c(C2=NC(O)CC23CCCCC3)c1 |
| InChI | InChI=1S/C17H23NO/c1-12-6-7-13(2)14(10-12)16-17(11-15(19)18-16)8-4-3-5-9-17/h6-7,10,15,19H,3-5,8-9,11H2,1-2H3 |
| InChIKey | AAHCOVCTCIGJLM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |