C21H16N4O2 — CID 132966245
14-methoxy-8-phenyl-3,9,10,18-tetrazatetracyclo[8.8.0.03,7.012,17]octadeca-1(18),4,6,8,12(17),13,15-heptaen-11-one (PubChem CID 132966245) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 14-methoxy-8-phenyl-3,9,10,18-tetrazatetracyclo[8.8.0.03,7.012,17]octadeca-1(18),4,6,8,12(17),13,15-heptaen-11-one.
| Compound Name | 14-methoxy-8-phenyl-3,9,10,18-tetrazatetracyclo[8.8.0.03,7.012,17]octadeca-1(18),4,6,8,12(17),13,15-heptaen-11-one |
|---|---|
| PubChem CID | 132966245 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 14-methoxy-8-phenyl-3,9,10,18-tetrazatetracyclo[8.8.0.03,7.012,17]octadeca-1(18),4,6,8,12(17),13,15-heptaen-11-one |
| SMILES | COc1ccc2nc3n(c(=O)c2c1)N=C(c1ccccc1)c1cccn1C3 |
| InChI | InChI=1S/C21H16N4O2/c1-27-15-9-10-17-16(12-15)21(26)25-19(22-17)13-24-11-5-8-18(24)20(23-25)14-6-3-2-4-7-14/h2-12H,13H2,1H3 |
| InChIKey | ZQWJIQCTRIPHHD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'} |
|---|