C46H50O10S — CID 132967079
(2S,3R,4S,5S,6R)-2-phenylsulfanyl-6-[[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 132967079) has the molecular formula C46H50O10S and a molecular weight of 794.96 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-phenylsulfanyl-6-[[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-phenylsulfanyl-6-[[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 132967079 |
| Molecular Formula | C46H50O10S |
| Molecular Weight | 794.96 g/mol |
| Exact Mass | 794.31 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-phenylsulfanyl-6-[[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)O[C@H](CO[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C46H50O10S/c47-39-37(56-46(41(49)40(39)48)57-36-24-14-5-15-25-36)31-54-45-44(53-29-35-22-12-4-13-23-35)43(52-28-34-20-10-3-11-21-34)42(51-27-33-18-8-2-9-19-33)38(55-45)30-50-26-32-16-6-1-7-17-32/h1-25,37-49H,26-31H2/t37-,38-,39-,40+,41-,42-,43+,44-,45+,46+/m1/s1 |
| InChIKey | VJQWTERWMWKVJN-AIZKHONTSA-N |
| XLogP | 6.30 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.96 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |