C16H22N4O — CID 132968634
1-cyclohexyl-2,5-dimethyl-N-(1H-pyrazol-4-yl)pyrrole-3-carboxamide (PubChem CID 132968634) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-cyclohexyl-2,5-dimethyl-N-(1H-pyrazol-4-yl)pyrrole-3-carboxamide.
| Compound Name | 1-cyclohexyl-2,5-dimethyl-N-(1H-pyrazol-4-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 132968634 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-cyclohexyl-2,5-dimethyl-N-(1H-pyrazol-4-yl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cn[nH]c2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C16H22N4O/c1-11-8-15(16(21)19-13-9-17-18-10-13)12(2)20(11)14-6-4-3-5-7-14/h8-10,14H,3-7H2,1-2H3,(H,17,18)(H,19,21) |
| InChIKey | FAXAUDPDWNITTQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |