C20H27N3O2 — CID 119420979
N-(2-amino-5-methoxyphenyl)-1-cyclohexyl-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 119420979) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-1-cyclohexyl-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-(2-amino-5-methoxyphenyl)-1-cyclohexyl-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 119420979 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-1-cyclohexyl-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(N)c(NC(=O)c2cc(C)n(C3CCCCC3)c2C)c1 |
| InChI | InChI=1S/C20H27N3O2/c1-13-11-17(14(2)23(13)15-7-5-4-6-8-15)20(24)22-19-12-16(25-3)9-10-18(19)21/h9-12,15H,4-8,21H2,1-3H3,(H,22,24) |
| InChIKey | GZIPUQLHHGGABR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|