C25H20N2O3 — CID 132969501
methyl 1-(2-oxo-1,2-diphenylethyl)-5-phenylpyrazole-3-carboxylate (PubChem CID 132969501) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is methyl 1-(2-oxo-1,2-diphenylethyl)-5-phenylpyrazole-3-carboxylate.
| Compound Name | methyl 1-(2-oxo-1,2-diphenylethyl)-5-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 132969501 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl 1-(2-oxo-1,2-diphenylethyl)-5-phenylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)n(C(C(=O)c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C25H20N2O3/c1-30-25(29)21-17-22(18-11-5-2-6-12-18)27(26-21)23(19-13-7-3-8-14-19)24(28)20-15-9-4-10-16-20/h2-17,23H,1H3 |
| InChIKey | DXQYCDQIXUITMD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |