C16H12FNO2 — CID 132969724
4-benzyl-2-(4-fluorophenyl)-4H-1,3-oxazol-5-one (PubChem CID 132969724) has the molecular formula C16H12FNO2 and a molecular weight of 269.28 g/mol. Its IUPAC name is 4-benzyl-2-(4-fluorophenyl)-4H-1,3-oxazol-5-one.
| Compound Name | 4-benzyl-2-(4-fluorophenyl)-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 132969724 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-benzyl-2-(4-fluorophenyl)-4H-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(F)cc2)=NC1Cc1ccccc1 |
| InChI | InChI=1S/C16H12FNO2/c17-13-8-6-12(7-9-13)15-18-14(16(19)20-15)10-11-4-2-1-3-5-11/h1-9,14H,10H2 |
| InChIKey | KZWKLCCKNWNGOO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |