C17H18N2OS2 — CID 132969782
4,5-bis(2,5-dimethylthiophen-3-yl)-2-methylpyridazin-3-one (PubChem CID 132969782) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 4,5-bis(2,5-dimethylthiophen-3-yl)-2-methylpyridazin-3-one.
| Compound Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 132969782 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-2-methylpyridazin-3-one |
| SMILES | Cc1cc(-c2cnn(C)c(=O)c2-c2cc(C)sc2C)c(C)s1 |
| InChI | InChI=1S/C17H18N2OS2/c1-9-6-13(11(3)21-9)15-8-18-19(5)17(20)16(15)14-7-10(2)22-12(14)4/h6-8H,1-5H3 |
| InChIKey | CZFGNFHISVDOKI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |