C16H18N4O4 — CID 132971327
5-amino-6-(2-benzylmorpholine-4-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 132971327) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 5-amino-6-(2-benzylmorpholine-4-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-amino-6-(2-benzylmorpholine-4-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 132971327 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 5-amino-6-(2-benzylmorpholine-4-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | Nc1c(C(=O)N2CCOC(Cc3ccccc3)C2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H18N4O4/c17-12-13(18-16(23)19-14(12)21)15(22)20-6-7-24-11(9-20)8-10-4-2-1-3-5-10/h1-5,11H,6-9,17H2,(H2,18,19,21,23) |
| InChIKey | RXNQMXYFWRNFKA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |