C14H18FNO5S — CID 132971348
4-[[(4-fluoro-3-methylphenyl)sulfonylamino]methyl]oxane-4-carboxylic acid (PubChem CID 132971348) has the molecular formula C14H18FNO5S and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-[[(4-fluoro-3-methylphenyl)sulfonylamino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(4-fluoro-3-methylphenyl)sulfonylamino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 132971348 |
| Molecular Formula | C14H18FNO5S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-[[(4-fluoro-3-methylphenyl)sulfonylamino]methyl]oxane-4-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)NCC2(C(=O)O)CCOCC2)ccc1F |
| InChI | InChI=1S/C14H18FNO5S/c1-10-8-11(2-3-12(10)15)22(19,20)16-9-14(13(17)18)4-6-21-7-5-14/h2-3,8,16H,4-7,9H2,1H3,(H,17,18) |
| InChIKey | DUNPVRRVPKOEBQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |