C15H20ClN3O3S — CID 132972010
3-chloro-N-[1-(2-morpholin-4-ylethyl)-5-oxopyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 132972010) has the molecular formula C15H20ClN3O3S and a molecular weight of 357.86 g/mol. Its IUPAC name is 3-chloro-N-[1-(2-morpholin-4-ylethyl)-5-oxopyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[1-(2-morpholin-4-ylethyl)-5-oxopyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 132972010 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-chloro-N-[1-(2-morpholin-4-ylethyl)-5-oxopyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CC(=O)N(CCN2CCOCC2)C1)c1sccc1Cl |
| InChI | InChI=1S/C15H20ClN3O3S/c16-12-1-8-23-14(12)15(21)17-11-9-13(20)19(10-11)3-2-18-4-6-22-7-5-18/h1,8,11H,2-7,9-10H2,(H,17,21) |
| InChIKey | FOPAJFWEXAUQSD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |