C14H14F3N3O4S — CID 132972483
3-[[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]sulfamoyl]-2-methylbenzoic acid (PubChem CID 132972483) has the molecular formula C14H14F3N3O4S and a molecular weight of 377.34 g/mol. Its IUPAC name is 3-[[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 3-[[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 132972483 |
| Molecular Formula | C14H14F3N3O4S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-[[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]sulfamoyl]-2-methylbenzoic acid |
| SMILES | CCn1ncc(NS(=O)(=O)c2cccc(C(=O)O)c2C)c1C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O4S/c1-3-20-12(14(15,16)17)10(7-18-20)19-25(23,24)11-6-4-5-9(8(11)2)13(21)22/h4-7,19H,3H2,1-2H3,(H,21,22) |
| InChIKey | LPTYYZCMOLCBJL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |