C25H36N4O4S — CID 132986738
N-butyl-2-[[2-[N-(dimethylsulfamoyl)anilino]acetyl]-[(3-methylphenyl)methyl]amino]propanamide (PubChem CID 132986738) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is N-butyl-2-[[2-[N-(dimethylsulfamoyl)anilino]acetyl]-[(3-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-[N-(dimethylsulfamoyl)anilino]acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132986738 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | N-butyl-2-[[2-[N-(dimethylsulfamoyl)anilino]acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(C)c1)C(=O)CN(c1ccccc1)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C25H36N4O4S/c1-6-7-16-26-25(31)21(3)28(18-22-13-11-12-20(2)17-22)24(30)19-29(34(32,33)27(4)5)23-14-9-8-10-15-23/h8-15,17,21H,6-7,16,18-19H2,1-5H3,(H,26,31) |
| InChIKey | VAFKKZWXZGTCLW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|