C23H27Cl3N2O3 — CID 132986839
N-butyl-2-[[2-(3-chlorophenoxy)acetyl]-[(2,4-dichlorophenyl)methyl]amino]butanamide (PubChem CID 132986839) has the molecular formula C23H27Cl3N2O3 and a molecular weight of 485.84 g/mol. Its IUPAC name is N-butyl-2-[[2-(3-chlorophenoxy)acetyl]-[(2,4-dichlorophenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(3-chlorophenoxy)acetyl]-[(2,4-dichlorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132986839 |
| Molecular Formula | C23H27Cl3N2O3 |
| Molecular Weight | 485.84 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-butyl-2-[[2-(3-chlorophenoxy)acetyl]-[(2,4-dichlorophenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1Cl)C(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H27Cl3N2O3/c1-3-5-11-27-23(30)21(4-2)28(14-16-9-10-18(25)13-20(16)26)22(29)15-31-19-8-6-7-17(24)12-19/h6-10,12-13,21H,3-5,11,14-15H2,1-2H3,(H,27,30) |
| InChIKey | GSFGYGIXXIYBSL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.84 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|