C30H34Cl2N2O3 — CID 133206873
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(3,5-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 133206873) has the molecular formula C30H34Cl2N2O3 and a molecular weight of 541.52 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(3,5-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(3,5-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206873 |
| Molecular Formula | C30H34Cl2N2O3 |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(3,5-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)COc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C30H34Cl2N2O3/c1-4-5-13-33-30(36)28(17-23-9-7-6-8-10-23)34(19-24-11-12-25(31)18-27(24)32)29(35)20-37-26-15-21(2)14-22(3)16-26/h6-12,14-16,18,28H,4-5,13,17,19-20H2,1-3H3,(H,33,36) |
| InChIKey | ZQESPJPHZRSARV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|