C32H32Cl2N2O3 — CID 100686634
(2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-3-phenylpropanamide (PubChem CID 100686634) has the molecular formula C32H32Cl2N2O3 and a molecular weight of 563.53 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100686634 |
| Molecular Formula | C32H32Cl2N2O3 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C32H32Cl2N2O3/c1-2-3-18-35-32(38)29(19-23-10-5-4-6-11-23)36(21-25-16-17-26(33)20-28(25)34)31(37)22-39-30-15-9-13-24-12-7-8-14-27(24)30/h4-17,20,29H,2-3,18-19,21-22H2,1H3,(H,35,38)/t29-/m0/s1 |
| InChIKey | GSDONBOQFHRJNN-LJAQVGFWSA-N |
| XLogP | 7.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|