C12H26O8S4 — CID 13298793
1,1,8,8-tetrakis(methylsulfonyl)octane (PubChem CID 13298793) has the molecular formula C12H26O8S4 and a molecular weight of 426.60 g/mol. Its IUPAC name is 1,1,8,8-tetrakis(methylsulfonyl)octane.
| Compound Name | 1,1,8,8-tetrakis(methylsulfonyl)octane |
|---|---|
| PubChem CID | 13298793 |
| Molecular Formula | C12H26O8S4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1,1,8,8-tetrakis(methylsulfonyl)octane |
| SMILES | CS(=O)(=O)C(CCCCCCC(S(C)(=O)=O)S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C12H26O8S4/c1-21(13,14)11(22(2,15)16)9-7-5-6-8-10-12(23(3,17)18)24(4,19)20/h11-12H,5-10H2,1-4H3 |
| InChIKey | LCEUUBUTOIYYPN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|