About tridecane-6-sulfonate
tridecane-6-sulfonate (PubChem CID 140615797) has the molecular formula C13H27O3S-
and a molecular weight of 263.42 g/mol. Its IUPAC name is tridecane-6-sulfonate.
Molecular Properties
| Compound Name | tridecane-6-sulfonate |
| PubChem CID | 140615797 |
| Molecular Formula | C13H27O3S- |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | tridecane-6-sulfonate |
| SMILES | CCCCCCCC(CCCCC)S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H28O3S/c1-3-5-7-8-10-12-13(17(14,15)16)11-9-6-4-2/h13H,3-12H2,1-2H3,(H,14,15,16)/p-1 |
| InChIKey | KTVQXHPSFBSSTJ-UHFFFAOYSA-M |
| XLogP | 3.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze tridecane-6-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecane-6-sulfonate?
The IUPAC name of tridecane-6-sulfonate (CID 140615797) is tridecane-6-sulfonate.
What is the SMILES notation for tridecane-6-sulfonate?
The canonical SMILES for tridecane-6-sulfonate is CCCCCCCC(CCCCC)S(=O)(=O)[O-].
What is the InChIKey of tridecane-6-sulfonate?
The InChIKey is KTVQXHPSFBSSTJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H28O3S/c1-3-5-7-8-10-12-13(17(14,15)16)11-9-6-4-2/h13H,3-12H2,1-2H3,(H,14,15,16)/p-1.
What are the key properties of tridecane-6-sulfonate?
tridecane-6-sulfonate has a molecular weight of 263.42 g/mol, XLogP of 3.84, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tridecane-6-sulfonate is sourced from PubChem (CID 140615797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).