C24H26O6 — CID 132988954
(2S)-2-[3,4-dihydroxy-2-(3-methylbut-2-enyl)-5-(2-methylprop-1-enyl)phenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one (PubChem CID 132988954) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2S)-2-[3,4-dihydroxy-2-(3-methylbut-2-enyl)-5-(2-methylprop-1-enyl)phenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-2-[3,4-dihydroxy-2-(3-methylbut-2-enyl)-5-(2-methylprop-1-enyl)phenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 132988954 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (2S)-2-[3,4-dihydroxy-2-(3-methylbut-2-enyl)-5-(2-methylprop-1-enyl)phenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCc1c([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc(C=C(C)C)c(O)c1O |
| InChI | InChI=1S/C24H26O6/c1-12(2)5-6-16-17(8-14(7-13(3)4)23(28)24(16)29)20-11-19(27)22-18(26)9-15(25)10-21(22)30-20/h5,7-10,20,25-26,28-29H,6,11H2,1-4H3/t20-/m0/s1 |
| InChIKey | QCMXRXGQMHTJNH-FQEVSTJZSA-N |
| XLogP | 5.15 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|