C18H20Cl2N2O2 — CID 132990407
tert-butyl 6,8-dichloro-3-pyrrolidin-1-ylquinoline-2-carboxylate (PubChem CID 132990407) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is tert-butyl 6,8-dichloro-3-pyrrolidin-1-ylquinoline-2-carboxylate.
| Compound Name | tert-butyl 6,8-dichloro-3-pyrrolidin-1-ylquinoline-2-carboxylate |
|---|---|
| PubChem CID | 132990407 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | tert-butyl 6,8-dichloro-3-pyrrolidin-1-ylquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc2c(Cl)cc(Cl)cc2cc1N1CCCC1 |
| InChI | InChI=1S/C18H20Cl2N2O2/c1-18(2,3)24-17(23)16-14(22-6-4-5-7-22)9-11-8-12(19)10-13(20)15(11)21-16/h8-10H,4-7H2,1-3H3 |
| InChIKey | KFHYXXLJUYCQBZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |