C21H23Cl2N3O3 — CID 167881776
tert-butyl 6-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]pyridine-2-carboxylate (PubChem CID 167881776) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is tert-butyl 6-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]pyridine-2-carboxylate.
| Compound Name | tert-butyl 6-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 167881776 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | tert-butyl 6-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cccc(N2CCN(C(=O)c3cc(Cl)cc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C21H23Cl2N3O3/c1-21(2,3)29-20(28)17-5-4-6-18(24-17)25-7-9-26(10-8-25)19(27)14-11-15(22)13-16(23)12-14/h4-6,11-13H,7-10H2,1-3H3 |
| InChIKey | YNCIKONIJVQRPN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |