C17H18Cl2N4O2 — CID 11589015
(4-amino-3,5-dichlorophenyl)-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 11589015) has the molecular formula C17H18Cl2N4O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 11589015 |
| Molecular Formula | C17H18Cl2N4O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | COc1cccc(N2CCN(C(=O)c3cc(Cl)c(N)c(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C17H18Cl2N4O2/c1-25-15-4-2-3-14(21-15)22-5-7-23(8-6-22)17(24)11-9-12(18)16(20)13(19)10-11/h2-4,9-10H,5-8,20H2,1H3 |
| InChIKey | HGBYXISOCNGFNT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|