C6H8O12P2 — CID 132991030
phospho-fructose phosphate (PubChem CID 132991030) has the molecular formula C6H8O12P2 and a molecular weight of 334.07 g/mol.
| Compound Name | phospho-fructose phosphate |
|---|---|
| PubChem CID | 132991030 |
| Molecular Formula | C6H8O12P2 |
| Molecular Weight | 334.07 g/mol |
| Exact Mass | 333.95 |
| IUPAC Name | — |
| SMILES | O=P(=O)C12O[C@@](O)(CO)[C@@H](O)[C@@]3(O)OP(=O)(O1)OC23O |
| InChI | InChI=1S/C6H8O12P2/c7-1-3(9)2(8)4(10)5(11)6(15-3,19(12)13)18-20(14,16-4)17-5/h2,7-11H,1H2/t2-,3+,4-,5?,6?,20?/m1/s1 |
| InChIKey | AXZPMEHEJIHSDB-GDDDZJRMSA-N |
| XLogP | -2.55 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.07 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|