C6H10O7 — CID 172914148
(1S,3S,4S,5S)-1,3-bis(hydroxymethyl)-2,6,7-trioxabicyclo[3.2.0]heptane-3,4-diol (PubChem CID 172914148) has the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. Its IUPAC name is (1S,3S,4S,5S)-1,3-bis(hydroxymethyl)-2,6,7-trioxabicyclo[3.2.0]heptane-3,4-diol.
| Compound Name | (1S,3S,4S,5S)-1,3-bis(hydroxymethyl)-2,6,7-trioxabicyclo[3.2.0]heptane-3,4-diol |
|---|---|
| PubChem CID | 172914148 |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (1S,3S,4S,5S)-1,3-bis(hydroxymethyl)-2,6,7-trioxabicyclo[3.2.0]heptane-3,4-diol |
| SMILES | OC[C@]12OO[C@H]1[C@H](O)[C@](O)(CO)O2 |
| InChI | InChI=1S/C6H10O7/c7-1-5(10)3(9)4-6(2-8,12-5)13-11-4/h3-4,7-10H,1-2H2/t3-,4-,5-,6-/m0/s1 |
| InChIKey | LUGALBPELIPCAL-BXKVDMCESA-N |
| XLogP | -2.92 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|