C12H22O12 — CID 142629034
(2R,3R,5S,6R)-1-[(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexane-1,2,3,4,5,6-hexol (PubChem CID 142629034) has the molecular formula C12H22O12 and a molecular weight of 358.30 g/mol. Its IUPAC name is (2R,3R,5S,6R)-1-[(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,5S,6R)-1-[(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 142629034 |
| Molecular Formula | C12H22O12 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (2R,3R,5S,6R)-1-[(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@]1(O)OC(C2(O)[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H22O12/c13-1-11(22)7(19)5(17)6(18)10(24-11)12(23)8(20)3(15)2(14)4(16)9(12)21/h2-10,13-23H,1H2/t2?,3-,4+,5-,6+,7+,8-,9-,10?,11+,12?/m1/s1 |
| InChIKey | DZIQRYZCAPAFAN-CANCATPMSA-N |
| XLogP | -7.30 |
| TPSA | 231.76 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | -7.30 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |