C9H12O8 — CID 170552365
[(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] prop-2-ynoate (PubChem CID 170552365) has the molecular formula C9H12O8 and a molecular weight of 248.19 g/mol. Its IUPAC name is [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] prop-2-ynoate.
| Compound Name | [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] prop-2-ynoate |
|---|---|
| PubChem CID | 170552365 |
| Molecular Formula | C9H12O8 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | [(3S,4R,5S,6S)-3,4,5,6-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl] prop-2-ynoate |
| SMILES | C#CC(=O)OC1O[C@@](O)(CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12O8/c1-2-4(11)16-8-6(13)5(12)7(14)9(15,3-10)17-8/h1,5-8,10,12-15H,3H2/t5-,6+,7+,8?,9+/m1/s1 |
| InChIKey | LPBKEFRVSYVRAQ-MYQIAPESSA-N |
| XLogP | -3.72 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|