C12H25NO12 — CID 140979265
6-amino-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 140979265) has the molecular formula C12H25NO12 and a molecular weight of 375.33 g/mol. Its IUPAC name is 6-amino-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | 6-amino-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140979265 |
| Molecular Formula | C12H25NO12 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 6-amino-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | NC1OC(O)(CO)C(O)C(O)C1O.OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO6.C6H12O6/c7-5-3(10)2(9)4(11)6(12,1-8)13-5;7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,8-12H,1,7H2;2-11H,1H2/t;2-,3-,4+,5-,6?/m.1/s1 |
| InChIKey | IPIPGLKCKOPGJG-MSPHXDAXSA-N |
| XLogP | -7.16 |
| TPSA | 246.78 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | -7.16 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |