C12H17NO6 — CID 132991546
3-[4-(carboxymethyl)-5-(dimethoxymethyl)-1H-pyrrol-3-yl]propanoic acid (PubChem CID 132991546) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-[4-(carboxymethyl)-5-(dimethoxymethyl)-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[4-(carboxymethyl)-5-(dimethoxymethyl)-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 132991546 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-[4-(carboxymethyl)-5-(dimethoxymethyl)-1H-pyrrol-3-yl]propanoic acid |
| SMILES | COC(OC)c1[nH]cc(CCC(=O)O)c1CC(=O)O |
| InChI | InChI=1S/C12H17NO6/c1-18-12(19-2)11-8(5-10(16)17)7(6-13-11)3-4-9(14)15/h6,12-13H,3-5H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | JIERFAOIUADKAZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|