C10H11F2NO4 — CID 15200635
3-[4-(carboxymethyl)-5-(difluoromethyl)-1H-pyrrol-3-yl]propanoic acid (PubChem CID 15200635) has the molecular formula C10H11F2NO4 and a molecular weight of 247.20 g/mol. Its IUPAC name is 3-[4-(carboxymethyl)-5-(difluoromethyl)-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[4-(carboxymethyl)-5-(difluoromethyl)-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 15200635 |
| Molecular Formula | C10H11F2NO4 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-[4-(carboxymethyl)-5-(difluoromethyl)-1H-pyrrol-3-yl]propanoic acid |
| SMILES | O=C(O)CCc1c[nH]c(C(F)F)c1CC(=O)O |
| InChI | InChI=1S/C10H11F2NO4/c11-10(12)9-6(3-8(16)17)5(4-13-9)1-2-7(14)15/h4,10,13H,1-3H2,(H,14,15)(H,16,17) |
| InChIKey | RRIYIONPWLNOGC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |