C9H10F2N2O3 — CID 133102873
2-[6-(aminomethyl)-2-(difluoromethyl)-4-oxo-1H-pyridin-3-yl]acetic acid (PubChem CID 133102873) has the molecular formula C9H10F2N2O3 and a molecular weight of 232.19 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-2-(difluoromethyl)-4-oxo-1H-pyridin-3-yl]acetic acid.
| Compound Name | 2-[6-(aminomethyl)-2-(difluoromethyl)-4-oxo-1H-pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 133102873 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[6-(aminomethyl)-2-(difluoromethyl)-4-oxo-1H-pyridin-3-yl]acetic acid |
| SMILES | NCc1cc(=O)c(CC(=O)O)c(C(F)F)[nH]1 |
| InChI | InChI=1S/C9H10F2N2O3/c10-9(11)8-5(2-7(15)16)6(14)1-4(3-12)13-8/h1,9H,2-3,12H2,(H,13,14)(H,15,16) |
| InChIKey | ABKLCPLWWMJOPE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |