C28H17BrN2O2 — CID 132991804
3-bromo-5,6-diphenylcinnolino[2,1-b]phthalazine-8,13-dione (PubChem CID 132991804) has the molecular formula C28H17BrN2O2 and a molecular weight of 493.36 g/mol. Its IUPAC name is 3-bromo-5,6-diphenylcinnolino[2,1-b]phthalazine-8,13-dione.
| Compound Name | 3-bromo-5,6-diphenylcinnolino[2,1-b]phthalazine-8,13-dione |
|---|---|
| PubChem CID | 132991804 |
| Molecular Formula | C28H17BrN2O2 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 3-bromo-5,6-diphenylcinnolino[2,1-b]phthalazine-8,13-dione |
| SMILES | O=c1c2ccccc2c(=O)n2c3ccc(Br)cc3c(-c3ccccc3)c(-c3ccccc3)n12 |
| InChI | InChI=1S/C28H17BrN2O2/c29-20-15-16-24-23(17-20)25(18-9-3-1-4-10-18)26(19-11-5-2-6-12-19)31-28(33)22-14-8-7-13-21(22)27(32)30(24)31/h1-17H |
| InChIKey | MLONAGRAISKLMZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 42.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|