C23H16N2O2 — CID 132991044
5-methyl-6-phenylcinnolino[2,1-b]phthalazine-8,13-dione (PubChem CID 132991044) has the molecular formula C23H16N2O2 and a molecular weight of 352.39 g/mol. Its IUPAC name is 5-methyl-6-phenylcinnolino[2,1-b]phthalazine-8,13-dione.
| Compound Name | 5-methyl-6-phenylcinnolino[2,1-b]phthalazine-8,13-dione |
|---|---|
| PubChem CID | 132991044 |
| Molecular Formula | C23H16N2O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-methyl-6-phenylcinnolino[2,1-b]phthalazine-8,13-dione |
| SMILES | Cc1c(-c2ccccc2)n2c(=O)c3ccccc3c(=O)n2c2ccccc12 |
| InChI | InChI=1S/C23H16N2O2/c1-15-17-11-7-8-14-20(17)24-22(26)18-12-5-6-13-19(18)23(27)25(24)21(15)16-9-3-2-4-10-16/h2-14H,1H3 |
| InChIKey | MRBAAYABGPHMKO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|