C25H44NO7P — CID 132993471
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxypropan-2-yl] icosa-4,7,10,13-tetraenoate (PubChem CID 132993471) has the molecular formula C25H44NO7P and a molecular weight of 501.60 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxypropan-2-yl] icosa-4,7,10,13-tetraenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxypropan-2-yl] icosa-4,7,10,13-tetraenoate |
|---|---|
| PubChem CID | 132993471 |
| Molecular Formula | C25H44NO7P |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxypropan-2-yl] icosa-4,7,10,13-tetraenoate |
| SMILES | CCCCCCC=CCC=CCC=CCC=CCCC(=O)OC(CO)COP(=O)(O)OCCN |
| InChI | InChI=1S/C25H44NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)33-24(22-27)23-32-34(29,30)31-21-20-26/h7-8,10-11,13-14,16-17,24,27H,2-6,9,12,15,18-23,26H2,1H3,(H,29,30) |
| InChIKey | SOFGMCJQWLTKCE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|