C23H46NO7P — CID 91086046
[(2S)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxypropan-2-yl] octadec-9-enoate (PubChem CID 91086046) has the molecular formula C23H46NO7P and a molecular weight of 479.60 g/mol. Its IUPAC name is [(2S)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxypropan-2-yl] octadec-9-enoate.
| Compound Name | [(2S)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxypropan-2-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 91086046 |
| Molecular Formula | C23H46NO7P |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | [(2S)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxypropan-2-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O[C@@H](CO)COP(=O)(O)OCCN |
| InChI | InChI=1S/C23H46NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(26)31-22(20-25)21-30-32(27,28)29-19-18-24/h9-10,22,25H,2-8,11-21,24H2,1H3,(H,27,28)/t22-/m0/s1 |
| InChIKey | NOVZJYYJYIFXJC-QFIPXVFZSA-N |
| XLogP | 5.02 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|